Difference between revisions of "Methyl-thioethers"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21110 == * transcription-direction: ** positive * right-end-position: ** 14509 * left-end-position: ** 7882 * centisome-position: ** 1.3041011...") |
(Created page with "Category:metabolite == Metabolite CPD-9451 == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[o-])c * inchi-key: ** njmgrjlqrlfqqx-hyxafxhysa-l *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9451 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-isopropylmaleate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c(c(=o)[o-])=cc(=o)[o-])c |
| − | * | + | * inchi-key: |
| − | ** | + | ** njmgrjlqrlfqqx-hyxafxhysa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 156.138 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
| − | == Reaction(s) | + | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]] |
| − | * [[ | + | * [[RXN-8991]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[3-ISOPROPYLMALISOM-RXN]] |
| − | * | + | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]] |
| − | * | + | * [[RXN-8991]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=2-isopropylmaleate}} |
| − | + | {{#set: inchi-key=inchikey=njmgrjlqrlfqqx-hyxafxhysa-l}} | |
| − | + | {{#set: molecular-weight=156.138}} | |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-9451
- common-name:
- 2-isopropylmaleate
- smiles:
- cc(c(c(=o)[o-])=cc(=o)[o-])c
- inchi-key:
- njmgrjlqrlfqqx-hyxafxhysa-l
- molecular-weight:
- 156.138
