Difference between revisions of "NADPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18662 == * transcription-direction: ** negative * right-end-position: ** 179693 * left-end-position: ** 174235 * centisome-position: ** 72.617584...")
(Created page with "Category:metabolite == Metabolite NADPH == * common-name: ** nadph * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18662 ==
+
== Metabolite NADPH ==
* transcription-direction:
+
* common-name:
** negative
+
** nadph
* right-end-position:
+
* smiles:
** 179693
+
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(cc=5)c(=o)n)
* left-end-position:
+
* inchi-key:
** 174235
+
** acfixjijdzmppo-nnyoxohssa-j
* centisome-position:
+
* molecular-weight:
** 72.617584   
+
** 741.394
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[1.1.1.188-RXN]]
* [[ATPASE-RXN]]
+
* [[1.1.1.197-RXN]]
** Category: [[annotation]]
+
* [[1.1.1.270-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[1.1.1.271-RXN]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[1.1.1.272-RXN]]
** Category: [[annotation]]
+
* [[1.1.1.34-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[1.1.1.64-RXN]]
* [[RXN-12195]]
+
* [[1.14.13.70-RXN]]
** Category: [[annotation]]
+
* [[1.14.13.78-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[1.14.13.79-RXN]]
* [[RXN-12196]]
+
* [[1.14.13.8-RXN]]
** Category: [[annotation]]
+
* [[1.18.1.2-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[1.2.1.18-RXN]]
* [[RXN0-5462]]
+
* [[1.3.99.5-RXN]]
** Category: [[annotation]]
+
* [[1.5.1.19-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
== Pathway(s) associated ==
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
* [[PWY-7210]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
* [[PWY-7198]]
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[3-OXOACYL-ACP-REDUCT-RXN]]
* [[PWY-7184]]
+
* [[ACETOLACTREDUCTOISOM-RXN]]
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[ACETOOHBUTREDUCTOISOM-RXN]]
* [[PWY-6545]]
+
* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[ALCDH_LPAREN_nadp_RPAREN_i]]
{{#set: transcription-direction=negative}}
+
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
{{#set: right-end-position=179693}}
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
{{#set: left-end-position=174235}}
+
* [[BTS_LPAREN_nadph_RPAREN_]]
{{#set: centisome-position=72.617584    }}
+
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
{{#set: nb reaction associated=5}}
+
* [[CORTISONE-ALPHA-REDUCTASE-RXN]]
{{#set: nb pathway associated=4}}
+
* [[D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN]]
 +
* [[DHFRi]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DIENOYLCOAREDUCT-RXN]]
 +
* [[DIHYDROFOLATEREDUCT-RXN]]
 +
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[DXPREDISOM-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[FOLR2]]
 +
* [[G3PD2]]
 +
* [[G5DH]]
 +
* [[G5DHm]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GLUCURONATE-REDUCTASE-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLUTRNAREDUCT-RXN]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 +
* [[IDS1]]
 +
* [[IDS2]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[KARI_LPAREN_23dhmb_RPAREN_]]
 +
* [[KARI_LPAREN_23dhmp_RPAREN_]]
 +
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 +
* [[L-XYLULOSE-REDUCTASE-RXN]]
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[MERCURY-II-REDUCTASE-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[MTHFO_LPAREN_nadp_RPAREN_]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 +
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 +
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 +
* [[NODOy]]
 +
* [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[PYRNUTRANSHYDROGEN-RXN]]
 +
* [[QOR-RXN]]
 +
* [[RETINOLSAT]]
 +
* [[RIBOFLAVINSYNREDUC-RXN]]
 +
* [[RXN-10060]]
 +
* [[RXN-10625]]
 +
* [[RXN-10655]]
 +
* [[RXN-10659]]
 +
* [[RXN-10717]]
 +
* [[RXN-10740]]
 +
* [[RXN-10841]]
 +
* [[RXN-1101]]
 +
* [[RXN-1102]]
 +
* [[RXN-1106]]
 +
* [[RXN-1121]]
 +
* [[RXN-1124]]
 +
* [[RXN-1125]]
 +
* [[RXN-11319]]
 +
* [[RXN-11476]]
 +
* [[RXN-11480]]
 +
* [[RXN-11878]]
 +
* [[RXN-11881]]
 +
* [[RXN-12078]]
 +
* [[RXN-12267]]
 +
* [[RXN-12484]]
 +
* [[RXN-12510]]
 +
* [[RXN-12521]]
 +
* [[RXN-12642]]
 +
* [[RXN-12645]]
 +
* [[RXN-12673]]
 +
* [[RXN-12747]]
 +
* [[RXN-13008]]
 +
* [[RXN-13139]]
 +
* [[RXN-13279]]
 +
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-13298]]
 +
* [[RXN-13299]]
 +
* [[RXN-13300]]
 +
* [[RXN-13301]]
 +
* [[RXN-13307]]
 +
* [[RXN-13308]]
 +
* [[RXN-13398]]
 +
* [[RXN-13431]]
 +
* [[RXN-13492]]
 +
* [[RXN-13493]]
 +
* [[RXN-13494]]
 +
* [[RXN-13506]]
 +
* [[RXN-13564]]
 +
* [[RXN-13565]]
 +
* [[RXN-13685]]
 +
* [[RXN-13686]]
 +
* [[RXN-13707]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 +
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81.]]
 +
* [[RXN-13719]]
 +
* [[RXN-13724]]
 +
* [[RXN-13961]]
 +
* [[RXN-14023]]
 +
* [[RXN-14171]]
 +
* [[RXN-14209]]
 +
* [[RXN-14246]]
 +
* [[RXN-14484]]
 +
* [[RXN-14493]]
 +
* [[RXN-14715]]
 +
* [[RXN-14776]]
 +
* [[RXN-14790]]
 +
* [[RXN-15006]]
 +
* [[RXN-15115]]
 +
* [[RXN-16016]]
 +
* [[RXN-16017]]
 +
* [[RXN-16095]]
 +
* [[RXN-16097]]
 +
* [[RXN-16112]]
 +
* [[RXN-16129]]
 +
* [[RXN-16154]]
 +
* [[RXN-16616]]
 +
* [[RXN-16622]]
 +
* [[RXN-16626]]
 +
* [[RXN-16630]]
 +
* [[RXN-17109]]
 +
* [[RXN-17426]]
 +
* [[RXN-17427]]
 +
* [[RXN-17428]]
 +
* [[RXN-17481]]
 +
* [[RXN-17482]]
 +
* [[RXN-17483]]
 +
* [[RXN-17484]]
 +
* [[RXN-17525]]
 +
* [[RXN-17678]]
 +
* [[RXN-17728]]
 +
* [[RXN-17773]]
 +
* [[RXN-17897]]
 +
* [[RXN-19202]]
 +
* [[RXN-21831]]
 +
* [[RXN-3142]]
 +
* [[RXN-4144]]
 +
* [[RXN-4210]]
 +
* [[RXN-4225]]
 +
* [[RXN-4231]]
 +
* [[RXN-5242]]
 +
* [[RXN-5285]]
 +
* [[RXN-5286]]
 +
* [[RXN-5482]]
 +
* [[RXN-5901]]
 +
* [[RXN-600]]
 +
* [[RXN-701]]
 +
* [[RXN-707]]
 +
* [[RXN-711]]
 +
* [[RXN-715]]
 +
* [[RXN-7580]]
 +
* [[RXN-7651]]
 +
* [[RXN-7658]]
 +
* [[RXN-7659]]
 +
* [[RXN-7660]]
 +
* [[RXN-7664]]
 +
* [[RXN-7665]]
 +
* [[RXN-7666]]
 +
* [[RXN-7676]]
 +
* [[RXN-7677]]
 +
* [[RXN-7698]]
 +
* [[RXN-773]]
 +
* [[RXN-7784]]
 +
* [[RXN-7835]]
 +
* [[RXN-7911]]
 +
* [[RXN-8772]]
 +
* [[RXN-8773]]
 +
* [[RXN-8789]]
 +
* [[RXN-8790]]
 +
* [[RXN-8791]]
 +
* [[RXN-8794]]
 +
* [[RXN-8795]]
 +
* [[RXN-8796]]
 +
* [[RXN-8853]]
 +
* [[RXN-9514]]
 +
* [[RXN-9515]]
 +
* [[RXN-9518]]
 +
* [[RXN-9521]]
 +
* [[RXN-9524]]
 +
* [[RXN-9526]]
 +
* [[RXN-9528]]
 +
* [[RXN-9530]]
 +
* [[RXN-9532]]
 +
* [[RXN-9534]]
 +
* [[RXN-9536]]
 +
* [[RXN-9538]]
 +
* [[RXN-9540]]
 +
* [[RXN-9542]]
 +
* [[RXN-9552]]
 +
* [[RXN-9556]]
 +
* [[RXN-9633]]
 +
* [[RXN-9725]]
 +
* [[RXN-9951]]
 +
* [[RXN-9971]]
 +
* [[RXN0-1281]]
 +
* [[RXN0-2142]]
 +
* [[RXN0-5101]]
 +
* [[RXN1A0-6303]]
 +
* [[RXN1F-10]]
 +
* [[RXN1F-160]]
 +
* [[RXN1F-161]]
 +
* [[RXN1F-72]]
 +
* [[RXN1G-157]]
 +
* [[RXN1G-349]]
 +
* [[RXN1G-469]]
 +
* [[RXN1G-508]]
 +
* [[RXN3O-130]]
 +
* [[RXN3O-5293]]
 +
* [[RXN66-11]]
 +
* [[RXN66-12]]
 +
* [[RXN66-13]]
 +
* [[RXN66-14]]
 +
* [[RXN66-19]]
 +
* [[RXN66-24]]
 +
* [[RXN66-27]]
 +
* [[RXN66-28]]
 +
* [[RXN66-303]]
 +
* [[RXN66-304]]
 +
* [[RXN66-305]]
 +
* [[RXN66-306]]
 +
* [[RXN66-314]]
 +
* [[RXN66-319]]
 +
* [[RXN66-321]]
 +
* [[RXN66-323]]
 +
* [[RXN66-343]]
 +
* [[RXN66-482]]
 +
* [[RXN66-81]]
 +
* [[RXNDQC-2]]
 +
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 +
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 +
* [[SMO]]
 +
* [[SULFITE-REDUCT-RXN]]
 +
* [[TDSR]]
 +
* [[THFOR2]]
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 +
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 +
* [[TRANSENOYLCOARED-RXN]]
 +
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 +
* [[TROPINE-DEHYDROGENASE-RXN]]
 +
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.188-RXN]]
 +
* [[1.1.1.197-RXN]]
 +
* [[1.1.1.270-RXN]]
 +
* [[1.1.1.272-RXN]]
 +
* [[1.1.1.34-RXN]]
 +
* [[1.18.1.2-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[1.3.1.20-RXN]]
 +
* [[2.1.1.135-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 +
* [[D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DXPREDISOM-RXN]]
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[G3PD2]]
 +
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PBDH]]
 +
* [[G6PBDHh]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[L-XYLULOSE-REDUCTASE-RXN]]
 +
* [[MALIC-NADP-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NADH-KINASE-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[RXN-10841]]
 +
* [[RXN-1124]]
 +
* [[RXN-12078]]
 +
* [[RXN-12267]]
 +
* [[RXN-12560]]
 +
* [[RXN-12642]]
 +
* [[RXN-12645]]
 +
* [[RXN-12747]]
 +
* [[RXN-13139]]
 +
* [[RXN-13279]]
 +
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 +
* [[RXN-13686]]
 +
* [[RXN-13719]]
 +
* [[RXN-14171]]
 +
* [[RXN-14209]]
 +
* [[RXN-14246]]
 +
* [[RXN-15115]]
 +
* [[RXN-17773]]
 +
* [[RXN-17897]]
 +
* [[RXN-5682]]
 +
* [[RXN-6002]]
 +
* [[RXN-701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7659]]
 +
* [[RXN-7660]]
 +
* [[RXN-8014]]
 +
* [[RXN-8772]]
 +
* [[RXN-8773]]
 +
* [[RXN-8789]]
 +
* [[RXN-8790]]
 +
* [[RXN-8791]]
 +
* [[RXN-9951]]
 +
* [[RXN-9952]]
 +
* [[RXN1F-72]]
 +
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 +
* [[SMO]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 +
* [[TRANS-RXN0-277]]
 +
* [[TROPINE-DEHYDROGENASE-RXN]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=nadph}}
 +
{{#set: inchi-key=inchikey=acfixjijdzmppo-nnyoxohssa-j}}
 +
{{#set: molecular-weight=741.394}}

Latest revision as of 11:12, 18 March 2021

Metabolite NADPH

  • common-name:
    • nadph
  • smiles:
    • c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(cc=5)c(=o)n)
  • inchi-key:
    • acfixjijdzmppo-nnyoxohssa-j
  • molecular-weight:
    • 741.394

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality