Difference between revisions of "POLYAMINSYN3-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-ACETYLGLUCOSAMINIDE BETA-ACETYLGLUCOSAMINIDE] == * common-name: ** an n-acetyl-β-d-gl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-ACETYLGLUCOSAMINIDE BETA-ACETYLGLUCOSAMINIDE] ==
 
* common-name:
 
* common-name:
** 5-chloro-5-deoxy-d-ribonate
+
** an n-acetyl-β-d-glucosaminyl-r
* smiles:
 
** c(=o)([o-])c(o)c(o)c(o)ccl
 
* inchi-key:
 
** ijqsocfskcenow-bxxzvtaosa-m
 
* molecular-weight:
 
** 183.568
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11717]]
+
* [[2.4.1.38-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-r}}
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
 
{{#set: molecular-weight=183.568}}
 

Revision as of 14:18, 26 August 2019

Metabolite BETA-ACETYLGLUCOSAMINIDE

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality