Difference between revisions of "PPI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01145 == * transcription-direction: ** positive * right-end-position: ** 369565 * left-end-position: ** 359999 * centisome-position: ** 64.98048...")
(Created page with "Category:metabolite == Metabolite PPI == * common-name: ** diphosphate * smiles: ** o=p(o)(op([o-])([o-])=o)[o-] * inchi-key: ** xppkvpweqaflfu-uhfffaoysa-k * molecular-we...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01145 ==
+
== Metabolite PPI ==
* transcription-direction:
+
* common-name:
** positive
+
** diphosphate
* right-end-position:
+
* smiles:
** 369565
+
** o=p(o)(op([o-])([o-])=o)[o-]
* left-end-position:
+
* inchi-key:
** 359999
+
** xppkvpweqaflfu-uhfffaoysa-k
* centisome-position:
+
* molecular-weight:
** 64.98048   
+
** 174.951
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[2.5.1.58-RXN]]
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
+
* [[2.7.1.90-RXN]]
** Category: [[annotation]]
+
* [[2.7.7.11-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.7.7.44-RXN]]
{{#set: transcription-direction=positive}}
+
* [[2.7.7.64-RXN]]
{{#set: right-end-position=369565}}
+
* [[APPRT]]
{{#set: left-end-position=359999}}
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
{{#set: centisome-position=64.98048    }}
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[GBDP]]
{{#set: nb reaction associated=1}}
+
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GPPSYN-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[HPRT]]
 +
* [[INORGPYROPHOSPHAT-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-11963]]
 +
* [[RXN-13760]]
 +
* [[RXN-14569]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-3701]]
 +
* [[RXN-7673]]
 +
* [[RXN1F-66]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TCM3]]
 +
* [[TCP26]]
 +
* [[TCX10]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
* [[XPPRT]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.5.1.32-RXN]]
 +
* [[2.5.1.41-RXN]]
 +
* [[2.5.1.42-RXN]]
 +
* [[2.5.1.58-RXN]]
 +
* [[2.7.1.90-RXN]]
 +
* [[2.7.7.1-RXN]]
 +
* [[2.7.7.11-RXN]]
 +
* [[2.7.7.14-RXN]]
 +
* [[2.7.7.15-RXN]]
 +
* [[2.7.7.44-RXN]]
 +
* [[2.7.7.60-RXN]]
 +
* [[2.7.7.64-RXN]]
 +
* [[4-COUMARATE--COA-LIGASE-RXN]]
 +
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 +
* [[6.1.1.24-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[6.3.4.10-RXN]]
 +
* [[6.3.4.11-RXN]]
 +
* [[6.3.4.9-RXN]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETOACETATE--COA-LIGASE-RXN]]
 +
* [[ACYLCOASYN-RXN]]
 +
* [[ADENPRIBOSYLTRAN-RXN]]
 +
* [[ADENYLATECYC-RXN]]
 +
* [[ADPART]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[APPRT]]
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ATP-PYROPHOSPHATASE-RXN]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[BIOTINLIG-RXN]]
 +
* [[BUTYRATE--COA-LIGASE-RXN]]
 +
* [[CDPDIGLYSYN-RXN]]
 +
* [[CHLPCTDh]]
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 +
* [[DCTP-PYROPHOSPHATASE-RXN]]
 +
* [[DGTD]]
 +
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
 +
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DUTNH]]
 +
* [[DUTP-PYROP-RXN]]
 +
* [[FACOAL18111Z]]
 +
* [[FADSYN-RXN]]
 +
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 +
* [[FPPS]]
 +
* [[FPPSYN-RXN]]
 +
* [[GBDP]]
 +
* [[GGPS]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[GPPS]]
 +
* [[GPPSYN-RXN]]
 +
* [[GSADENYLATION-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[GUANYLCYC-RXN]]
 +
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 +
* [[H2PTEROATESYNTH-RXN]]
 +
* [[HEMEOSYN-RXN]]
 +
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 +
* [[HISTPRATPHYD-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 +
* [[ITPP]]
 +
* [[LEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[LNLCCOAL]]
 +
* [[LNLNCACOAL]]
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[NICONUCADENYLYLTRAN-RXN]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[NTDP]]
 +
* [[NTPD]]
 +
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 +
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[P-PANTOCYSLIG-RXN]]
 +
* [[PANTEPADENYLYLTRAN-RXN]]
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 +
* [[PPGPPSYN-RXN]]
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[QUINOPRIBOTRANS-RXN]]
 +
* [[R223-RXN]]
 +
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[RNA-LIGASE-ATP-RXN]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-10919]]
 +
* [[RXN-1126]]
 +
* [[RXN-11361]]
 +
* [[RXN-11396]]
 +
* [[RXN-11486]]
 +
* [[RXN-11488]]
 +
* [[RXN-11963]]
 +
* [[RXN-12184]]
 +
* [[RXN-12263]]
 +
* [[RXN-12502]]
 +
* [[RXN-12503]]
 +
* [[RXN-12610]]
 +
* [[RXN-12611]]
 +
* [[RXN-12720]]
 +
* [[RXN-12978]]
 +
* [[RXN-13162]]
 +
* [[RXN-13290]]
 +
* [[RXN-13323]]
 +
* [[RXN-13614]]
 +
* [[RXN-13724]]
 +
* [[RXN-13760]]
 +
* [[RXN-14139]]
 +
* [[RXN-14140]]
 +
* [[RXN-14270]]
 +
* [[RXN-14552]]
 +
* [[RXN-14569]]
 +
* [[RXN-14929]]
 +
* [[RXN-15284]]
 +
* [[RXN-15285]]
 +
* [[RXN-15287]]
 +
* [[RXN-15713]]
 +
* [[RXN-16165]]
 +
* [[RXN-16380]]
 +
* [[RXN-16389]]
 +
* [[RXN-16393]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[RXN-16415]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-16418]]
 +
* [[RXN-16820]]
 +
* [[RXN-16821]]
 +
* [[RXN-17127]]
 +
* [[RXN-17480]]
 +
* [[RXN-17573]]
 +
* [[RXN-17809]]
 +
* [[RXN-17917]]
 +
* [[RXN-17921]]
 +
* [[RXN-17925]]
 +
* [[RXN-1961]]
 +
* [[RXN-2001]]
 +
* [[RXN-2541]]
 +
* [[RXN-2761]]
 +
* [[RXN-3701]]
 +
* [[RXN-4303]]
 +
* [[RXN-4305]]
 +
* [[RXN-4307]]
 +
* [[RXN-7663]]
 +
* [[RXN-7673]]
 +
* [[RXN-7674]]
 +
* [[RXN-7810]]
 +
* [[RXN-7811]]
 +
* [[RXN-7813]]
 +
* [[RXN-7904]]
 +
* [[RXN-8344]]
 +
* [[RXN-8654]]
 +
* [[RXN-8788]]
 +
* [[RXN-8999]]
 +
* [[RXN-9003]]
 +
* [[RXN-9386]]
 +
* [[RXN-9623]]
 +
* [[RXN-9644]]
 +
* [[RXN-9673]]
 +
* [[RXN-9969]]
 +
* [[RXN0-1141]]
 +
* [[RXN0-1602]]
 +
* [[RXN0-1603]]
 +
* [[RXN0-2023]]
 +
* [[RXN0-2161]]
 +
* [[RXN0-383]]
 +
* [[RXN0-384]]
 +
* [[RXN0-385]]
 +
* [[RXN0-5021]]
 +
* [[RXN0-5098]]
 +
* [[RXN0-5107]]
 +
* [[RXN0-5180]]
 +
* [[RXN0-5515]]
 +
* [[RXN0-6274]]
 +
* [[RXN0-6382]]
 +
* [[RXN0-6427]]
 +
* [[RXN0-6957]]
 +
* [[RXN0-7192]]
 +
* [[RXN0-7238]]
 +
* [[RXN0-7239]]
 +
* [[RXN0-7248]]
 +
* [[RXN1F-66]]
 +
* [[RXN1G-121]]
 +
* [[RXN66-281]]
 +
* [[RXN66-469]]
 +
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
 +
* [[RXN66-477]]
 +
* [[RXN66-480]]
 +
* [[RXN66-483]]
 +
* [[RXN66-484]]
 +
* [[RXNARA-8002]]
 +
* [[S-ADENMETSYN-RXN]]
 +
* [[SERINE--TRNA-LIGASE-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TCM3]]
 +
* [[TCP26]]
 +
* [[TCX10]]
 +
* [[THI-P-SYN-RXN]]
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 +
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 +
* [[TRANS-RXN0-623]]
 +
* [[TRIPHOSPHATASE-RXN]]
 +
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 +
* [[TYROSINE--TRNA-LIGASE-RXN]]
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
* [[UG1PUT]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
* [[UTPPH]]
 +
* [[VALINE--TRNA-LIGASE-RXN]]
 +
* [[XPPRT]]
 +
* [[llcoas]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=diphosphate}}
 +
{{#set: inchi-key=inchikey=xppkvpweqaflfu-uhfffaoysa-k}}
 +
{{#set: molecular-weight=174.951}}

Latest revision as of 11:14, 18 March 2021

Metabolite PPI

  • common-name:
    • diphosphate
  • smiles:
    • o=p(o)(op([o-])([o-])=o)[o-]
  • inchi-key:
    • xppkvpweqaflfu-uhfffaoysa-k
  • molecular-weight:
    • 174.951

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality