Difference between revisions of "PWY-6105"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+== Pathway PWY-6105 ==
+* taxonomic-range:
+** tax-38879
 * common-name:
-** &omega;-saturated c55 dolichol phosphate
+** botryococcenes and methylated squalene biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
+* [[RXN-12263]]
-* inchi-key:
+* [[RXN-13724]]
-** ktgsdhzxakcyhm-lstwdcehsa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-13291 RXN-13291]
-** 849.311
+* [NoneRXN-13283 RXN-13283]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13311 RXN-13311]
-* [[RXN-16602]]
+* [NoneRXN-13284 RXN-13284]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-13310 RXN-13310]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-13282 RXN-13282]
-{{#set: common-name=&omega;-saturated c55 dolichol phosphate}}
+* [NoneRXN-13285 RXN-13285]
-{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
+{{#set: taxonomic-range=tax-38879}}
-{{#set: molecular-weight=849.311}}
+{{#set: common-name=botryococcenes and methylated squalene biosynthesis}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.22}}
+{{#set: nb total reaction=9}}