Difference between revisions of "PWY-7072"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+...")
 
(Created page with "Category:pathway == Pathway PWY-7072 == * taxonomic-range: ** tax-2 * common-name: ** hopanoid biosynthesis (bacteria) == Reaction(s) found == * RXN-12263 == Reaction(...")
 
(9 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] ==
+
== Pathway PWY-7072 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** nω-hydroxy-l-arginine
+
** hopanoid biosynthesis (bacteria)
* smiles:
+
== Reaction(s) found ==
** c(nc(no)=[n+])ccc([n+])c([o-])=o
+
* [[RXN-12263]]
* inchi-key:
+
== Reaction(s) not found ==
** fqwravymzulpnk-bypyzucnsa-o
+
* [NoneRXN-13528 RXN-13528]
* molecular-weight:
+
* [NoneRXN-13533 RXN-13533]
** 191.209
+
* [NoneRXN-13531 RXN-13531]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12337 RXN-12337]
* [[RXN-13565]]
+
* [NoneRXN-17128 RXN-17128]
== Reaction(s) known to produce the compound ==
+
* [None5.4.99.17-RXN 5.4.99.17-RXN]
* [[RXN-13564]]
+
* [NoneRXN-13534 RXN-13534]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-13530 RXN-13530]
{{#set: common-name=nω-hydroxy-l-arginine}}
+
* [NoneRXN-4961 RXN-4961]
{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
+
* [NoneRXN-13529 RXN-13529]
{{#set: molecular-weight=191.209}}
+
* [NoneRXN-13532 RXN-13532]
 +
* [NoneRXN-13535 RXN-13535]
 +
* [NoneRXN-17129 RXN-17129]
 +
{{#set: taxonomic-range=tax-2}}
 +
{{#set: common-name=hopanoid biosynthesis (bacteria)}}
 +
{{#set: nb reaction found=1}}
 +
{{#set: completion rate=0.07}}
 +
{{#set: nb total reaction=14}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7072

  • taxonomic-range:
    • tax-2
  • common-name:
    • hopanoid biosynthesis (bacteria)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13528 RXN-13528]
  • [NoneRXN-13533 RXN-13533]
  • [NoneRXN-13531 RXN-13531]
  • [NoneRXN-12337 RXN-12337]
  • [NoneRXN-17128 RXN-17128]
  • [None5.4.99.17-RXN 5.4.99.17-RXN]
  • [NoneRXN-13534 RXN-13534]
  • [NoneRXN-13530 RXN-13530]
  • [NoneRXN-4961 RXN-4961]
  • [NoneRXN-13529 RXN-13529]
  • [NoneRXN-13532 RXN-13532]
  • [NoneRXN-13535 RXN-13535]
  • [NoneRXN-17129 RXN-17129]