Difference between revisions of "S-N-METHYLCOCLAURINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20622 == * transcription-direction: ** negative * right-end-position: ** 166682 * left-end-position: ** 157286 * centisome-position: ** 25.510084...")
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * smiles: ** cc(c)c(o)(cc(=o)[o-])c([o-])=o * inchi-key: ** b...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20622 ==
+
== Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (2s)-2-isopropylmalate
−
* right-end-position:
+
* smiles:
−
** 166682
+
** cc(c)c(o)(cc(=o)[o-])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 157286
+
** bityxlxucsktjs-zetcqymhsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 25.510084   
+
** 174.153
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3-ISOPROPYLMALISOM-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-13163]]
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[2-ISOPROPYLMALATESYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[3-ISOPROPYLMALISOM-RXN]]
−
** Category: [[orthology]]
+
* [[IPMS]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-13163]]
−
{{#set: transcription-direction=negative}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: right-end-position=166682}}
+
{{#set: common-name=(2s)-2-isopropylmalate}}
−
{{#set: left-end-position=157286}}
+
{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
−
{{#set: centisome-position=25.510084    }}
+
{{#set: molecular-weight=174.153}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE

  • common-name:
    • (2s)-2-isopropylmalate
  • smiles:
    • cc(c)c(o)(cc(=o)[o-])c([o-])=o
  • inchi-key:
    • bityxlxucsktjs-zetcqymhsa-l
  • molecular-weight:
    • 174.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-N-METHYLCOCLAURINE&oldid=46035"