Difference between revisions of "S-N-METHYLCOCLAURINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20622 == * transcription-direction: ** negative * right-end-position: ** 166682 * left-end-position: ** 157286 * centisome-position: ** 25.510084...") |
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * smiles: ** cc(c)c(o)(cc(=o)[o-])c([o-])=o * inchi-key: ** b...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == |
− | * | + | * common-name: |
− | ** | + | ** (2s)-2-isopropylmalate |
− | * | + | * smiles: |
− | ** | + | ** cc(c)c(o)(cc(=o)[o-])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** bityxlxucsktjs-zetcqymhsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 174.153 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[3-ISOPROPYLMALISOM-RXN]] |
− | == Reaction(s) | + | * [[RXN-13163]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2-ISOPROPYLMALATESYN-RXN]] |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | * | + | * [[IPMS]] |
− | * | + | * [[RXN-13163]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=(2s)-2-isopropylmalate}} |
− | + | {{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=174.153}} |
− | {{#set: | ||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE
- common-name:
- (2s)-2-isopropylmalate
- smiles:
- cc(c)c(o)(cc(=o)[o-])c([o-])=o
- inchi-key:
- bityxlxucsktjs-zetcqymhsa-l
- molecular-weight:
- 174.153