Difference between revisions of "UDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01932 == * transcription-direction: ** positive * right-end-position: ** 114343 * left-end-position: ** 110218 * centisome-position: ** 76.66699...")
 
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** xcctyiawtas...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01932 ==
+
== Metabolite UDP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** udp
−
* right-end-position:
+
* smiles:
−
** 114343
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 110218
+
** xcctyiawtasojw-xvfcmesisa-k
−
* centisome-position:
+
* molecular-weight:
−
** 76.66699   
+
** 401.14
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.4.1.198-RXN]]
−
== Reaction(s) associated ==
+
* [[2.4.1.229-RXN]]
−
* [[PMPOXI-RXN]]
+
* [[2.4.1.94-RXN]]
−
** Category: [[annotation]]
+
* [[ATUD]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATUDm]]
−
** Category: [[orthology]]
+
* [[DUDT]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[R00157]]
−
* [[PNPOXI-RXN]]
+
* [[RXN-11627]]
−
** Category: [[annotation]]
+
* [[RXN-11889]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-11890]]
−
** Category: [[orthology]]
+
* [[RXN-12197]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14841]]
−
* [[PYRIDOXINE-4-OXIDASE-RXN]]
+
* [[RXN-16027]]
−
** Category: [[orthology]]
+
* [[RXN-7873]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN0-722]]
−
== Pathway(s) associated ==
+
* [[UDPGth]]
−
* [[PLPSAL-PWY]]
+
* [[UDPKIN-RXN]]
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[UDPREDUCT-RXN]]
−
* [[PWY-7204]]
+
* [[UMPU]]
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PYRIDOXSYN-PWY]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
* [[PWY-7282]]
+
* [[2.4.1.101-RXN]]
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[2.4.1.117-RXN]]
−
* [[PWY-5499]]
+
* [[2.4.1.122-RXN]]
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
* [[2.4.1.123-RXN]]
−
{{#set: transcription-direction=positive}}
+
* [[2.4.1.134-RXN]]
−
{{#set: right-end-position=114343}}
+
* [[2.4.1.141-RXN]]
−
{{#set: left-end-position=110218}}
+
* [[2.4.1.145-RXN]]
−
{{#set: centisome-position=76.66699    }}
+
* [[2.4.1.151-RXN]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[2.4.1.155-RXN]]
−
{{#set: nb reaction associated=3}}
+
* [[2.4.1.198-RXN]]
−
{{#set: nb pathway associated=5}}
+
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.212-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.225-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.38-RXN]]
 +
* [[2.4.1.46-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.4.2.26-RXN]]
 +
* [[2.4.2.38-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[R00157]]
 +
* [[RXN-10606]]
 +
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-12002]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-12196]]
 +
* [[RXN-1225]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-14561]]
 +
* [[RXN-14841]]
 +
* [[RXN-15117]]
 +
* [[RXN-15205]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-16975]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-6501]]
 +
* [[RXN-7667]]
 +
* [[RXN-7828]]
 +
* [[RXN-7873]]
 +
* [[RXN-8228]]
 +
* [[RXN-9000]]
 +
* [[RXN-9104]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UDPGth]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UTCY]]
 +
* [[UTUP]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp}}
 +
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
 +
{{#set: molecular-weight=401.14}}

Latest revision as of 11:14, 18 March 2021

Metabolite UDP

  • common-name:
    • udp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • xcctyiawtasojw-xvfcmesisa-k
  • molecular-weight:
    • 401.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP&oldid=138301"